C21H40N2O5 — CID 157480749
tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-methylpiperidine-1-carboxylate (PubChem CID 157480749) has the molecular formula C21H40N2O5 and a molecular weight of 418.67 g/mol. Its IUPAC name is tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 157480749 |
| Molecular Formula | C21H40N2O5 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.41 |
| IUPAC Name | tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,3,3,4,5,5,6,6-nonadeuterio-4-methylpiperidine-1-carboxylate |
| SMILES | [2H]C1([2H])N(C(=O)OC(C)(C)C)C([2H])([2H])C([2H])([2H])C([2H])(C)C1([2H])[2H].[2H]C1([2H])N(C(=O)OC(C)(C)C)C([2H])([2H])C([2H])([2H])C([2H])(O)C1([2H])[2H] |
| InChI | InChI=1S/C11H21NO2.C10H19NO3/c1-9-5-7-12(8-6-9)10(13)14-11(2,3)4;1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h9H,5-8H2,1-4H3;8,12H,4-7H2,1-3H3/i5D2,6D2,7D2,8D2,9D;4D2,5D2,6D2,7D2,8D |
| InChIKey | BWCZAXSDSWPEJJ-DZEAPJISSA-N |
| XLogP | 4.03 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |