C53H70N4O4 — CID 157480922
(3S,4R)-N,N-dibenzyl-3-methoxypiperidin-4-amine;ethyl 6-[(3S,4R)-4-(dibenzylamino)-3-methoxypiperidin-1-yl]hexanoate;penta-1,3-diyne (PubChem CID 157480922) has the molecular formula C53H70N4O4 and a molecular weight of 827.17 g/mol. Its IUPAC name is (3S,4R)-N,N-dibenzyl-3-methoxypiperidin-4-amine;ethyl 6-[(3S,4R)-4-(dibenzylamino)-3-methoxypiperidin-1-yl]hexanoate;penta-1,3-diyne.
| Compound Name | (3S,4R)-N,N-dibenzyl-3-methoxypiperidin-4-amine;ethyl 6-[(3S,4R)-4-(dibenzylamino)-3-methoxypiperidin-1-yl]hexanoate;penta-1,3-diyne |
|---|---|
| PubChem CID | 157480922 |
| Molecular Formula | C53H70N4O4 |
| Molecular Weight | 827.17 g/mol |
| Exact Mass | 826.54 |
| IUPAC Name | (3S,4R)-N,N-dibenzyl-3-methoxypiperidin-4-amine;ethyl 6-[(3S,4R)-4-(dibenzylamino)-3-methoxypiperidin-1-yl]hexanoate;penta-1,3-diyne |
| SMILES | C#CC#CC.CCOC(=O)CCCCCN1CC[C@@H](N(Cc2ccccc2)Cc2ccccc2)[C@@H](OC)C1.CO[C@H]1CNCC[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H40N2O3.C20H26N2O.C5H4/c1-3-33-28(31)17-11-6-12-19-29-20-18-26(27(23-29)32-2)30(21-24-13-7-4-8-14-24)22-25-15-9-5-10-16-25;1-23-20-14-21-13-12-19(20)22(15-17-8-4-2-5-9-17)16-18-10-6-3-7-11-18;1-3-5-4-2/h4-5,7-10,13-16,26-27H,3,6,11-12,17-23H2,1-2H3;2-11,19-21H,12-16H2,1H3;1H,2H3/t26-,27+;19-,20+;/m11./s1 |
| InChIKey | BWDMWOOXMBNCHA-QYITXAQLSA-N |
| XLogP | 8.61 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.17 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|