About 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate
4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate (PubChem CID 157482273) has the molecular formula C22H19BrN2O2
and a molecular weight of 423.31 g/mol. Its IUPAC name is 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate |
| PubChem CID | 157482273 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate |
| SMILES | COC(=O)c1ccnc2c(C)cccc12.Cc1cccc2c(Br)ccnc12 |
| InChI | InChI=1S/C12H11NO2.C10H8BrN/c1-8-4-3-5-9-10(12(14)15-2)6-7-13-11(8)9;1-7-3-2-4-8-9(11)5-6-12-10(7)8/h3-7H,1-2H3;2-6H,1H3 |
| InChIKey | BWHIKMXRLHWVOQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate?
The IUPAC name of 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate (CID 157482273) is 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate.
What is the SMILES notation for 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate?
The canonical SMILES for 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate is COC(=O)c1ccnc2c(C)cccc12.Cc1cccc2c(Br)ccnc12.
What is the InChIKey of 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate?
The InChIKey is BWHIKMXRLHWVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.C10H8BrN/c1-8-4-3-5-9-10(12(14)15-2)6-7-13-11(8)9;1-7-3-2-4-8-9(11)5-6-12-10(7)8/h3-7H,1-2H3;2-6H,1H3.
What are the key properties of 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate?
4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate has a molecular weight of 423.31 g/mol, XLogP of 5.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-8-methylquinoline;methyl 8-methylquinoline-4-carboxylate is sourced from PubChem (CID 157482273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).