C10H5Cl — CID 157483205
9-chlorodeca-1,2,3,4,5,6,7,9-octaene (PubChem CID 157483205) has the molecular formula C10H5Cl and a molecular weight of 160.60 g/mol. Its IUPAC name is 9-chlorodeca-1,2,3,4,5,6,7,9-octaene.
| Compound Name | 9-chlorodeca-1,2,3,4,5,6,7,9-octaene |
|---|---|
| PubChem CID | 157483205 |
| Molecular Formula | C10H5Cl |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 9-chlorodeca-1,2,3,4,5,6,7,9-octaene |
| SMILES | C=C=C=C=C=C=C=CC(=C)Cl |
| InChI | InChI=1S/C10H5Cl/c1-3-4-5-6-7-8-9-10(2)11/h9H,1-2H2 |
| InChIKey | PYTSNGBNILNFKM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|