C17H14Cl2F3N5O3S2 — CID 157484161
3-chloro-N-[(1R)-1-[2-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethylsulfonyl)benzamide;sulfane (PubChem CID 157484161) has the molecular formula C17H14Cl2F3N5O3S2 and a molecular weight of 528.37 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-[2-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethylsulfonyl)benzamide;sulfane.
| Compound Name | 3-chloro-N-[(1R)-1-[2-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethylsulfonyl)benzamide;sulfane |
|---|---|
| PubChem CID | 157484161 |
| Molecular Formula | C17H14Cl2F3N5O3S2 |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | 3-chloro-N-[(1R)-1-[2-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethylsulfonyl)benzamide;sulfane |
| SMILES | C[C@@H](NC(=O)c1cc(Cl)cc(S(=O)(=O)C(F)(F)F)c1)c1ncnn1-c1ccnc(Cl)c1.S |
| InChI | InChI=1S/C17H12Cl2F3N5O3S.H2S/c1-9(15-24-8-25-27(15)12-2-3-23-14(19)7-12)26-16(28)10-4-11(18)6-13(5-10)31(29,30)17(20,21)22;/h2-9H,1H3,(H,26,28);1H2/t9-;/m1./s1 |
| InChIKey | BWMWQZHPGUXUJF-SBSPUUFOSA-N |
| XLogP | 3.87 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|