C13H28O3S — CID 157484455
ethyl (3S)-3-(methoxymethyl)-6,6-dimethylheptanoate;sulfane (PubChem CID 157484455) has the molecular formula C13H28O3S and a molecular weight of 264.43 g/mol. Its IUPAC name is ethyl (3S)-3-(methoxymethyl)-6,6-dimethylheptanoate;sulfane.
| Compound Name | ethyl (3S)-3-(methoxymethyl)-6,6-dimethylheptanoate;sulfane |
|---|---|
| PubChem CID | 157484455 |
| Molecular Formula | C13H28O3S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethyl (3S)-3-(methoxymethyl)-6,6-dimethylheptanoate;sulfane |
| SMILES | CCOC(=O)C[C@H](CCC(C)(C)C)COC.S |
| InChI | InChI=1S/C13H26O3.H2S/c1-6-16-12(14)9-11(10-15-5)7-8-13(2,3)4;/h11H,6-10H2,1-5H3;1H2/t11-;/m0./s1 |
| InChIKey | BWNSSUYPUJDDPU-MERQFXBCSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |