C12H18O3 — CID 15748469
(3aR,6S,6aR)-6-methylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one (PubChem CID 15748469) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3aR,6S,6aR)-6-methylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one.
| Compound Name | (3aR,6S,6aR)-6-methylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 15748469 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3aR,6S,6aR)-6-methylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C12H18O3/c1-8-7-9(13)11-10(8)14-12(15-11)5-3-2-4-6-12/h8,10-11H,2-7H2,1H3/t8-,10+,11-/m0/s1 |
| InChIKey | XOPJKHKRHBHWBS-GDPRMGEGSA-N |
| XLogP | 2.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |