C12H18O7S — CID 15748487
[(3aR,6R,6aR)-4-oxospiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl methanesulfonate (PubChem CID 15748487) has the molecular formula C12H18O7S and a molecular weight of 306.34 g/mol. Its IUPAC name is [(3aR,6R,6aR)-4-oxospiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl methanesulfonate.
| Compound Name | [(3aR,6R,6aR)-4-oxospiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 15748487 |
| Molecular Formula | C12H18O7S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [(3aR,6R,6aR)-4-oxospiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1OC(=O)[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C12H18O7S/c1-20(14,15)16-7-8-9-10(11(13)17-8)19-12(18-9)5-3-2-4-6-12/h8-10H,2-7H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | AGLKCABNJVZDLA-OPRDCNLKSA-N |
| XLogP | 0.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|