About dimethyliodanium;tetramethylazanium;trimethylsulfanium
dimethyliodanium;tetramethylazanium;trimethylsulfanium (PubChem CID 157484876) has the molecular formula C9H27INS+3
and a molecular weight of 308.29 g/mol. Its IUPAC name is dimethyliodanium;tetramethylazanium;trimethylsulfanium.
Molecular Properties
| Compound Name | dimethyliodanium;tetramethylazanium;trimethylsulfanium |
| PubChem CID | 157484876 |
| Molecular Formula | C9H27INS+3 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | dimethyliodanium;tetramethylazanium;trimethylsulfanium |
| SMILES | C[I+]C.C[N+](C)(C)C.C[S+](C)C |
| InChI | InChI=1S/C4H12N.C3H9S.C2H6I/c1-5(2,3)4;1-4(2)3;1-3-2/h1-4H3;1-3H3;1-2H3/q3*+1 |
| InChIKey | BWOZTPBAMQNBKD-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyliodanium;tetramethylazanium;trimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyliodanium;tetramethylazanium;trimethylsulfanium?
The IUPAC name of dimethyliodanium;tetramethylazanium;trimethylsulfanium (CID 157484876) is dimethyliodanium;tetramethylazanium;trimethylsulfanium.
What is the SMILES notation for dimethyliodanium;tetramethylazanium;trimethylsulfanium?
The canonical SMILES for dimethyliodanium;tetramethylazanium;trimethylsulfanium is C[I+]C.C[N+](C)(C)C.C[S+](C)C.
What is the InChIKey of dimethyliodanium;tetramethylazanium;trimethylsulfanium?
The InChIKey is BWOZTPBAMQNBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.C3H9S.C2H6I/c1-5(2,3)4;1-4(2)3;1-3-2/h1-4H3;1-3H3;1-2H3/q3*+1.
What are the key properties of dimethyliodanium;tetramethylazanium;trimethylsulfanium?
dimethyliodanium;tetramethylazanium;trimethylsulfanium has a molecular weight of 308.29 g/mol, XLogP of -1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyliodanium;tetramethylazanium;trimethylsulfanium is sourced from PubChem (CID 157484876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).