C13H20O3 — CID 15748491
(3aR,6S,6aS)-4-ethylspiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-6-ol (PubChem CID 15748491) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3aR,6S,6aS)-4-ethylspiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-6-ol.
| Compound Name | (3aR,6S,6aS)-4-ethylspiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-6-ol |
|---|---|
| PubChem CID | 15748491 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3aR,6S,6aS)-4-ethylspiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-6-ol |
| SMILES | CCC1=C[C@H](O)[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C13H20O3/c1-2-9-8-10(14)12-11(9)15-13(16-12)6-4-3-5-7-13/h8,10-12,14H,2-7H2,1H3/t10-,11+,12-/m0/s1 |
| InChIKey | NLKVXQPPYXGGBV-TUAOUCFPSA-N |
| XLogP | 2.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|