C32H28F3IN8O4S2 — CID 157485317
2-(3,4-dimethoxyphenyl)-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole;5-[2-(3,4-dimethoxyphenyl)-6-methylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 157485317) has the molecular formula C32H28F3IN8O4S2 and a molecular weight of 836.66 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole;5-[2-(3,4-dimethoxyphenyl)-6-methylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole;5-[2-(3,4-dimethoxyphenyl)-6-methylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 157485317 |
| Molecular Formula | C32H28F3IN8O4S2 |
| Molecular Weight | 836.66 g/mol |
| Exact Mass | 836.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole;5-[2-(3,4-dimethoxyphenyl)-6-methylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(-c2nn3c(-c4cnc(N)c(C(F)(F)F)c4)c(C)nc3s2)cc1OC.COc1ccc(-c2nn3c(I)c(C)nc3s2)cc1OC |
| InChI | InChI=1S/C19H16F3N5O2S.C13H12IN3O2S/c1-9-15(11-6-12(19(20,21)22)16(23)24-8-11)27-18(25-9)30-17(26-27)10-4-5-13(28-2)14(7-10)29-3;1-7-11(14)17-13(15-7)20-12(16-17)8-4-5-9(18-2)10(6-8)19-3/h4-8H,1-3H3,(H2,23,24);4-6H,1-3H3 |
| InChIKey | BWQLABGSLMGLSA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.66 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|