C18H35ClN4OSi — CID 157485787
tert-butyl-[2-(4,5-dimethylimidazol-1-yl)ethoxy]-dimethylsilane;4,5-dimethyl-1H-imidazole;hydrochloride (PubChem CID 157485787) has the molecular formula C18H35ClN4OSi and a molecular weight of 387.04 g/mol. Its IUPAC name is tert-butyl-[2-(4,5-dimethylimidazol-1-yl)ethoxy]-dimethylsilane;4,5-dimethyl-1H-imidazole;hydrochloride.
| Compound Name | tert-butyl-[2-(4,5-dimethylimidazol-1-yl)ethoxy]-dimethylsilane;4,5-dimethyl-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 157485787 |
| Molecular Formula | C18H35ClN4OSi |
| Molecular Weight | 387.04 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl-[2-(4,5-dimethylimidazol-1-yl)ethoxy]-dimethylsilane;4,5-dimethyl-1H-imidazole;hydrochloride |
| SMILES | Cc1nc[nH]c1C.Cc1ncn(CCO[Si](C)(C)C(C)(C)C)c1C.Cl |
| InChI | InChI=1S/C13H26N2OSi.C5H8N2.ClH/c1-11-12(2)15(10-14-11)8-9-16-17(6,7)13(3,4)5;1-4-5(2)7-3-6-4;/h10H,8-9H2,1-7H3;3H,1-2H3,(H,6,7);1H |
| InChIKey | DXHDJZNWGYAIAN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.04 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|