C16H28O6S — CID 157485906
2,5-bis[2-(2-ethoxyethoxy)ethoxy]thiophene (PubChem CID 157485906) has the molecular formula C16H28O6S and a molecular weight of 348.46 g/mol. Its IUPAC name is 2,5-bis[2-(2-ethoxyethoxy)ethoxy]thiophene.
| Compound Name | 2,5-bis[2-(2-ethoxyethoxy)ethoxy]thiophene |
|---|---|
| PubChem CID | 157485906 |
| Molecular Formula | C16H28O6S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2,5-bis[2-(2-ethoxyethoxy)ethoxy]thiophene |
| SMILES | CCOCCOCCOc1ccc(OCCOCCOCC)s1 |
| InChI | InChI=1S/C16H28O6S/c1-3-17-7-9-19-11-13-21-15-5-6-16(23-15)22-14-12-20-10-8-18-4-2/h5-6H,3-4,7-14H2,1-2H3 |
| InChIKey | BWSBXGPKRHYYNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|