C29H32N2O4 — CID 157486567
1-[1-(3,4-dimethoxyphenyl)-9H-indeno[2,1-c]pyridin-3-yl]-5-morpholin-4-ylpentan-1-one (PubChem CID 157486567) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)-9H-indeno[2,1-c]pyridin-3-yl]-5-morpholin-4-ylpentan-1-one.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)-9H-indeno[2,1-c]pyridin-3-yl]-5-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 157486567 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)-9H-indeno[2,1-c]pyridin-3-yl]-5-morpholin-4-ylpentan-1-one |
| SMILES | COc1ccc(-c2nc(C(=O)CCCCN3CCOCC3)cc3c2Cc2ccccc2-3)cc1OC |
| InChI | InChI=1S/C29H32N2O4/c1-33-27-11-10-21(18-28(27)34-2)29-24-17-20-7-3-4-8-22(20)23(24)19-25(30-29)26(32)9-5-6-12-31-13-15-35-16-14-31/h3-4,7-8,10-11,18-19H,5-6,9,12-17H2,1-2H3 |
| InChIKey | BWTZBHPUULCXHL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|