C36H24Cl2F3N3O5 — CID 157486727
[3-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]-2-oxoacetyl]-2-(trifluoromethyl)phenyl]-2-oxopropyl] 2,6-dichlorobenzoate (PubChem CID 157486727) has the molecular formula C36H24Cl2F3N3O5 and a molecular weight of 706.50 g/mol. Its IUPAC name is [3-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]-2-oxoacetyl]-2-(trifluoromethyl)phenyl]-2-oxopropyl] 2,6-dichlorobenzoate.
| Compound Name | [3-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]-2-oxoacetyl]-2-(trifluoromethyl)phenyl]-2-oxopropyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 157486727 |
| Molecular Formula | C36H24Cl2F3N3O5 |
| Molecular Weight | 706.50 g/mol |
| Exact Mass | 705.10 |
| IUPAC Name | [3-[4-[2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]-2-oxoacetyl]-2-(trifluoromethyl)phenyl]-2-oxopropyl] 2,6-dichlorobenzoate |
| SMILES | Cc1ccc(C(=O)C(=O)c2ccc(CC(=O)COC(=O)c3c(Cl)cccc3Cl)c(C(F)(F)F)c2)cc1Cc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C36H24Cl2F3N3O5/c1-20-7-8-22(14-25(20)17-31-43-13-11-30(44-31)24-4-3-12-42-18-24)33(46)34(47)23-10-9-21(27(16-23)36(39,40)41)15-26(45)19-49-35(48)32-28(37)5-2-6-29(32)38/h2-14,16,18H,15,17,19H2,1H3 |
| InChIKey | LGWBRWNRRHCSNJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 116.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.50 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|