About 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide
1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 157486755) has the molecular formula C16H34N4O
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide.
Molecular Properties
| Compound Name | 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide |
| PubChem CID | 157486755 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCN1CCC(N)CC1.CCN1CCC(NC(C)=O)CC1 |
| InChI | InChI=1S/C9H18N2O.C7H16N2/c1-3-11-6-4-9(5-7-11)10-8(2)12;1-2-9-5-3-7(8)4-6-9/h9H,3-7H2,1-2H3,(H,10,12);7H,2-6,8H2,1H3 |
| InChIKey | BWUPORWDXLFIAB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide?
The IUPAC name of 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide (CID 157486755) is 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide.
What is the SMILES notation for 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide?
The canonical SMILES for 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide is CCN1CCC(N)CC1.CCN1CCC(NC(C)=O)CC1.
What is the InChIKey of 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide?
The InChIKey is BWUPORWDXLFIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C7H16N2/c1-3-11-6-4-9(5-7-11)10-8(2)12;1-2-9-5-3-7(8)4-6-9/h9H,3-7H2,1-2H3,(H,10,12);7H,2-6,8H2,1H3.
What are the key properties of 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide?
1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide has a molecular weight of 298.47 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpiperidin-4-amine;N-(1-ethylpiperidin-4-yl)acetamide is sourced from PubChem (CID 157486755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).