About ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium
ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium (PubChem CID 157489182) has the molecular formula C9H23N
and a molecular weight of 145.29 g/mol. Its IUPAC name is ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium |
| PubChem CID | 157489182 |
| Molecular Formula | C9H23N |
| Molecular Weight | 145.29 g/mol |
| Exact Mass | 145.18 |
| IUPAC Name | ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium |
| SMILES | C.CC.[CH2-][NH+]1CC[C@@H](C)C1 |
| InChI | InChI=1S/C6H13N.C2H6.CH4/c1-6-3-4-7(2)5-6;1-2;/h6-7H,2-5H2,1H3;1-2H3;1H4/t6-;;/m1../s1 |
| InChIKey | BXBJYJKFVLYTDX-QYCVXMPOSA-N |
| XLogP | 1.36 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium?
The IUPAC name of ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium (CID 157489182) is ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium.
What is the SMILES notation for ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium?
The canonical SMILES for ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium is C.CC.[CH2-][NH+]1CC[C@@H](C)C1.
What is the InChIKey of ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium?
The InChIKey is BXBJYJKFVLYTDX-QYCVXMPOSA-N. The full InChI is InChI=1S/C6H13N.C2H6.CH4/c1-6-3-4-7(2)5-6;1-2;/h6-7H,2-5H2,1H3;1-2H3;1H4/t6-;;/m1../s1.
What are the key properties of ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium?
ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium has a molecular weight of 145.29 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(3R)-1-methanidyl-3-methylpyrrolidin-1-ium is sourced from PubChem (CID 157489182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).