About 3,3-diethoxy-N,N-diethylpropan-1-amine
3,3-diethoxy-N,N-diethylpropan-1-amine (PubChem CID 15749029) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3,3-diethoxy-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3,3-diethoxy-N,N-diethylpropan-1-amine |
| PubChem CID | 15749029 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 3,3-diethoxy-N,N-diethylpropan-1-amine |
| SMILES | CCOC(CCN(CC)CC)OCC |
| InChI | InChI=1S/C11H25NO2/c1-5-12(6-2)10-9-11(13-7-3)14-8-4/h11H,5-10H2,1-4H3 |
| InChIKey | IBQQRWHQSLKUHC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxy-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxy-N,N-diethylpropan-1-amine?
The IUPAC name of 3,3-diethoxy-N,N-diethylpropan-1-amine (CID 15749029) is 3,3-diethoxy-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3,3-diethoxy-N,N-diethylpropan-1-amine?
The canonical SMILES for 3,3-diethoxy-N,N-diethylpropan-1-amine is CCOC(CCN(CC)CC)OCC.
What is the InChIKey of 3,3-diethoxy-N,N-diethylpropan-1-amine?
The InChIKey is IBQQRWHQSLKUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2/c1-5-12(6-2)10-9-11(13-7-3)14-8-4/h11H,5-10H2,1-4H3.
What are the key properties of 3,3-diethoxy-N,N-diethylpropan-1-amine?
3,3-diethoxy-N,N-diethylpropan-1-amine has a molecular weight of 203.33 g/mol, XLogP of 2.12, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxy-N,N-diethylpropan-1-amine is sourced from PubChem (CID 15749029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).