About methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide
methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide (PubChem CID 157490404) has the molecular formula C22H29F3N4O
and a molecular weight of 422.50 g/mol. Its IUPAC name is methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide.
Molecular Properties
| Compound Name | methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide |
| PubChem CID | 157490404 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide |
| SMILES | C.NNC(=O)Cc1ccc(CCc2ccc(N3CCNCC3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3N4O.CH4/c22-21(23,24)19-14-18(28-11-9-26-10-12-28)8-7-17(19)6-5-15-1-3-16(4-2-15)13-20(29)27-25;/h1-4,7-8,14,26H,5-6,9-13,25H2,(H,27,29);1H4 |
| InChIKey | BXEXZRHBFVCGEK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide?
The IUPAC name of methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide (CID 157490404) is methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide.
What is the SMILES notation for methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide?
The canonical SMILES for methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide is C.NNC(=O)Cc1ccc(CCc2ccc(N3CCNCC3)cc2C(F)(F)F)cc1.
What is the InChIKey of methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide?
The InChIKey is BXEXZRHBFVCGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F3N4O.CH4/c22-21(23,24)19-14-18(28-11-9-26-10-12-28)8-7-17(19)6-5-15-1-3-16(4-2-15)13-20(29)27-25;/h1-4,7-8,14,26H,5-6,9-13,25H2,(H,27,29);1H4.
What are the key properties of methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide?
methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide has a molecular weight of 422.50 g/mol, XLogP of 3.07, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-[4-[2-[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]ethyl]phenyl]acetohydrazide is sourced from PubChem (CID 157490404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).