C26H25Cl2F3N6O2 — CID 157491011
tert-butyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate;2-chloro-5-fluoropyridin-4-amine;5-fluoro-2-phenylpyridin-4-amine (PubChem CID 157491011) has the molecular formula C26H25Cl2F3N6O2 and a molecular weight of 581.43 g/mol. Its IUPAC name is tert-butyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate;2-chloro-5-fluoropyridin-4-amine;5-fluoro-2-phenylpyridin-4-amine.
| Compound Name | tert-butyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate;2-chloro-5-fluoropyridin-4-amine;5-fluoro-2-phenylpyridin-4-amine |
|---|---|
| PubChem CID | 157491011 |
| Molecular Formula | C26H25Cl2F3N6O2 |
| Molecular Weight | 581.43 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | tert-butyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate;2-chloro-5-fluoropyridin-4-amine;5-fluoro-2-phenylpyridin-4-amine |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)ncc1F.Nc1cc(-c2ccccc2)ncc1F.Nc1cc(Cl)ncc1F |
| InChI | InChI=1S/C11H9FN2.C10H12ClFN2O2.C5H4ClFN2/c12-9-7-14-11(6-10(9)13)8-4-2-1-3-5-8;1-10(2,3)16-9(15)14-7-4-8(11)13-5-6(7)12;6-5-1-4(8)3(7)2-9-5/h1-7H,(H2,13,14);4-5H,1-3H3,(H,13,14,15);1-2H,(H2,8,9) |
| InChIKey | BXGUNRXWMAMBJS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.43 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|