About CID 157491242
CID 157491242 (PubChem CID 157491242) has the molecular formula C6H14BN2O3
and a molecular weight of 173.00 g/mol.
Molecular Properties
| Compound Name | CID 157491242 |
| PubChem CID | 157491242 |
| Molecular Formula | C6H14BN2O3 |
| Molecular Weight | 173.00 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | — |
| SMILES | CNC([B]OCCN)C(=O)OC |
| InChI | InChI=1S/C6H14BN2O3/c1-9-5(6(10)11-2)7-12-4-3-8/h5,9H,3-4,8H2,1-2H3 |
| InChIKey | IVEJZSFHAKFVFA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.00 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157491242 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157491242?
The IUPAC name of CID 157491242 (CID 157491242) is not available.
What is the SMILES notation for CID 157491242?
The canonical SMILES for CID 157491242 is CNC([B]OCCN)C(=O)OC.
What is the InChIKey of CID 157491242?
The InChIKey is IVEJZSFHAKFVFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14BN2O3/c1-9-5(6(10)11-2)7-12-4-3-8/h5,9H,3-4,8H2,1-2H3.
What are the key properties of CID 157491242?
CID 157491242 has a molecular weight of 173.00 g/mol, XLogP of -1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157491242 is sourced from PubChem (CID 157491242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).