C34H36Br2N4O2Si — CID 157491376
[3-(6-bromoindazol-1-yl)phenyl]methanol;[3-(6-bromoindazol-1-yl)phenyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 157491376) has the molecular formula C34H36Br2N4O2Si and a molecular weight of 720.58 g/mol. Its IUPAC name is [3-(6-bromoindazol-1-yl)phenyl]methanol;[3-(6-bromoindazol-1-yl)phenyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [3-(6-bromoindazol-1-yl)phenyl]methanol;[3-(6-bromoindazol-1-yl)phenyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 157491376 |
| Molecular Formula | C34H36Br2N4O2Si |
| Molecular Weight | 720.58 g/mol |
| Exact Mass | 718.10 |
| IUPAC Name | [3-(6-bromoindazol-1-yl)phenyl]methanol;[3-(6-bromoindazol-1-yl)phenyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(-n2ncc3ccc(Br)cc32)c1.OCc1cccc(-n2ncc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C20H25BrN2OSi.C14H11BrN2O/c1-20(2,3)25(4,5)24-14-15-7-6-8-18(11-15)23-19-12-17(21)10-9-16(19)13-22-23;15-12-5-4-11-8-16-17(14(11)7-12)13-3-1-2-10(6-13)9-18/h6-13H,14H2,1-5H3;1-8,18H,9H2 |
| InChIKey | BXHVPVWVEITOJP-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.58 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|