C48H51N7O4 — CID 157491460
tert-butyl N-[1-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]cyclobutyl]carbamate;2-N-[4-(1-methylcyclobutyl)phenyl]-6-phenylpyridine-2,3-diamine (PubChem CID 157491460) has the molecular formula C48H51N7O4 and a molecular weight of 789.98 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]cyclobutyl]carbamate;2-N-[4-(1-methylcyclobutyl)phenyl]-6-phenylpyridine-2,3-diamine.
| Compound Name | tert-butyl N-[1-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]cyclobutyl]carbamate;2-N-[4-(1-methylcyclobutyl)phenyl]-6-phenylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 157491460 |
| Molecular Formula | C48H51N7O4 |
| Molecular Weight | 789.98 g/mol |
| Exact Mass | 789.40 |
| IUPAC Name | tert-butyl N-[1-[4-[(3-nitro-6-phenyl-2-pyridinyl)amino]phenyl]cyclobutyl]carbamate;2-N-[4-(1-methylcyclobutyl)phenyl]-6-phenylpyridine-2,3-diamine |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(Nc3nc(-c4ccccc4)ccc3[N+](=O)[O-])cc2)CCC1.CC1(c2ccc(Nc3nc(-c4ccccc4)ccc3N)cc2)CCC1 |
| InChI | InChI=1S/C26H28N4O4.C22H23N3/c1-25(2,3)34-24(31)29-26(16-7-17-26)19-10-12-20(13-11-19)27-23-22(30(32)33)15-14-21(28-23)18-8-5-4-6-9-18;1-22(14-5-15-22)17-8-10-18(11-9-17)24-21-19(23)12-13-20(25-21)16-6-3-2-4-7-16/h4-6,8-15H,7,16-17H2,1-3H3,(H,27,28)(H,29,31);2-4,6-13H,5,14-15,23H2,1H3,(H,24,25) |
| InChIKey | BXIBPBCPCKNMIR-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.98 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|