About 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole)
1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) (PubChem CID 157492890) has the molecular formula C17H26N4
and a molecular weight of 286.42 g/mol. Its IUPAC name is 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole).
Molecular Properties
| Compound Name | 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) |
| PubChem CID | 157492890 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) |
| SMILES | Cc1ccn(C)c1.Cc1ccn(C)c1.Cc1cn(C)cn1 |
| InChI | InChI=1S/2C6H9N.C5H8N2/c2*1-6-3-4-7(2)5-6;1-5-3-7(2)4-6-5/h2*3-5H,1-2H3;3-4H,1-2H3 |
| InChIKey | BXMJXUPEXSKJGL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole)?
The IUPAC name of 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) (CID 157492890) is 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole).
What is the SMILES notation for 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole)?
The canonical SMILES for 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) is Cc1ccn(C)c1.Cc1ccn(C)c1.Cc1cn(C)cn1.
What is the InChIKey of 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole)?
The InChIKey is BXMJXUPEXSKJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9N.C5H8N2/c2*1-6-3-4-7(2)5-6;1-5-3-7(2)4-6-5/h2*3-5H,1-2H3;3-4H,1-2H3.
What are the key properties of 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole)?
1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) has a molecular weight of 286.42 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylimidazole;bis(1,3-dimethylpyrrole) is sourced from PubChem (CID 157492890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).