C15H26O2Si — CID 157493283
7-ethyl-3,3-di(propan-2-yl)-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one (PubChem CID 157493283) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is 7-ethyl-3,3-di(propan-2-yl)-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one.
| Compound Name | 7-ethyl-3,3-di(propan-2-yl)-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one |
|---|---|
| PubChem CID | 157493283 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 7-ethyl-3,3-di(propan-2-yl)-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one |
| SMILES | CCC1=C2CO[Si](C(C)C)(C(C)C)CC2CC1=O |
| InChI | InChI=1S/C15H26O2Si/c1-6-13-14-8-17-18(10(2)3,11(4)5)9-12(14)7-15(13)16/h10-12H,6-9H2,1-5H3 |
| InChIKey | ADEUYAVRHXYYCX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|