C83H68 — CID 157493896
9-methylphenanthrene;1-methyl-4-phenylnaphthalene;1-methyl-5-phenylnaphthalene;2-(4-methylphenyl)naphthalene;2-methyl-6-phenylnaphthalene (PubChem CID 157493896) has the molecular formula C83H68 and a molecular weight of 1065.46 g/mol. Its IUPAC name is 9-methylphenanthrene;1-methyl-4-phenylnaphthalene;1-methyl-5-phenylnaphthalene;2-(4-methylphenyl)naphthalene;2-methyl-6-phenylnaphthalene.
| Compound Name | 9-methylphenanthrene;1-methyl-4-phenylnaphthalene;1-methyl-5-phenylnaphthalene;2-(4-methylphenyl)naphthalene;2-methyl-6-phenylnaphthalene |
|---|---|
| PubChem CID | 157493896 |
| Molecular Formula | C83H68 |
| Molecular Weight | 1065.46 g/mol |
| Exact Mass | 1064.53 |
| IUPAC Name | 9-methylphenanthrene;1-methyl-4-phenylnaphthalene;1-methyl-5-phenylnaphthalene;2-(4-methylphenyl)naphthalene;2-methyl-6-phenylnaphthalene |
| SMILES | Cc1cc2ccccc2c2ccccc12.Cc1ccc(-c2ccc3ccccc3c2)cc1.Cc1ccc(-c2ccccc2)c2ccccc12.Cc1ccc2cc(-c3ccccc3)ccc2c1.Cc1cccc2c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/4C17H14.C15H12/c1-13-7-5-12-17-15(13)10-6-11-16(17)14-8-3-2-4-9-14;1-13-11-12-16(14-7-3-2-4-8-14)17-10-6-5-9-15(13)17;1-13-6-8-15(9-7-13)17-11-10-14-4-2-3-5-16(14)12-17;1-13-7-8-17-12-16(10-9-15(17)11-13)14-5-3-2-4-6-14;1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15/h4*2-12H,1H3;2-10H,1H3 |
| InChIKey | BXPCWPDHENUELX-UHFFFAOYSA-N |
| XLogP | 23.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.46 |
| LogP ≤ 5 | 23.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|