C17H14N2O4 — CID 157494387
1H-3,1-benzoxazine-2,4-dione;8-methyl-2H-1,3-benzoxazine (PubChem CID 157494387) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1H-3,1-benzoxazine-2,4-dione;8-methyl-2H-1,3-benzoxazine.
| Compound Name | 1H-3,1-benzoxazine-2,4-dione;8-methyl-2H-1,3-benzoxazine |
|---|---|
| PubChem CID | 157494387 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1H-3,1-benzoxazine-2,4-dione;8-methyl-2H-1,3-benzoxazine |
| SMILES | Cc1cccc2c1OCN=C2.O=c1[nH]c2ccccc2c(=O)o1 |
| InChI | InChI=1S/C9H9NO.C8H5NO3/c1-7-3-2-4-8-5-10-6-11-9(7)8;10-7-5-3-1-2-4-6(5)9-8(11)12-7/h2-5H,6H2,1H3;1-4H,(H,9,11) |
| InChIKey | BXQOLTCPELLWKM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |