About (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine
(2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine (PubChem CID 15749446) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine.
Molecular Properties
| Compound Name | (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine |
| PubChem CID | 15749446 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine |
| SMILES | C[C@]1(c2ccccc2)OC[C@H]([C@@H]2CCCCN2)O1 |
| InChI | InChI=1S/C15H21NO2/c1-15(12-7-3-2-4-8-12)17-11-14(18-15)13-9-5-6-10-16-13/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | PSSUWQYMIZSKML-ZNMIVQPWSA-N |
| XLogP | 2.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine?
The IUPAC name of (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine (CID 15749446) is (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine.
What is the SMILES notation for (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine?
The canonical SMILES for (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine is C[C@]1(c2ccccc2)OC[C@H]([C@@H]2CCCCN2)O1.
What is the InChIKey of (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine?
The InChIKey is PSSUWQYMIZSKML-ZNMIVQPWSA-N. The full InChI is InChI=1S/C15H21NO2/c1-15(12-7-3-2-4-8-12)17-11-14(18-15)13-9-5-6-10-16-13/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3/t13-,14+,15-/m0/s1.
What are the key properties of (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine?
(2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine has a molecular weight of 247.34 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2S,4S)-2-methyl-2-phenyl-1,3-dioxolan-4-yl]piperidine is sourced from PubChem (CID 15749446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).