C18H27NO2 — CID 15749449
(2S)-2-[(2S,4S)-2-butyl-2-phenyl-1,3-dioxolan-4-yl]piperidine (PubChem CID 15749449) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-2-[(2S,4S)-2-butyl-2-phenyl-1,3-dioxolan-4-yl]piperidine.
| Compound Name | (2S)-2-[(2S,4S)-2-butyl-2-phenyl-1,3-dioxolan-4-yl]piperidine |
|---|---|
| PubChem CID | 15749449 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2S)-2-[(2S,4S)-2-butyl-2-phenyl-1,3-dioxolan-4-yl]piperidine |
| SMILES | CCCC[C@]1(c2ccccc2)OC[C@H]([C@@H]2CCCCN2)O1 |
| InChI | InChI=1S/C18H27NO2/c1-2-3-12-18(15-9-5-4-6-10-15)20-14-17(21-18)16-11-7-8-13-19-16/h4-6,9-10,16-17,19H,2-3,7-8,11-14H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | QXJLJTMEWKPCIU-KSZLIROESA-N |
| XLogP | 3.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |