C16H22ClNO2 — CID 15749464
(2S)-2-[(2S,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]piperidine (PubChem CID 15749464) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (2S)-2-[(2S,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]piperidine.
| Compound Name | (2S)-2-[(2S,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]piperidine |
|---|---|
| PubChem CID | 15749464 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S)-2-[(2S,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]piperidine |
| SMILES | CC[C@]1(c2ccc(Cl)cc2)OC[C@H]([C@@H]2CCCCN2)O1 |
| InChI | InChI=1S/C16H22ClNO2/c1-2-16(12-6-8-13(17)9-7-12)19-11-15(20-16)14-5-3-4-10-18-14/h6-9,14-15,18H,2-5,10-11H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | YSQJODXOFGPEQN-XHSDSOJGSA-N |
| XLogP | 3.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |