C16H23NO3 — CID 15749466
3-[(2S,4S)-2-ethyl-4-[(2S)-piperidin-2-yl]-1,3-dioxolan-2-yl]phenol (PubChem CID 15749466) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[(2S,4S)-2-ethyl-4-[(2S)-piperidin-2-yl]-1,3-dioxolan-2-yl]phenol.
| Compound Name | 3-[(2S,4S)-2-ethyl-4-[(2S)-piperidin-2-yl]-1,3-dioxolan-2-yl]phenol |
|---|---|
| PubChem CID | 15749466 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-[(2S,4S)-2-ethyl-4-[(2S)-piperidin-2-yl]-1,3-dioxolan-2-yl]phenol |
| SMILES | CC[C@]1(c2cccc(O)c2)OC[C@H]([C@@H]2CCCCN2)O1 |
| InChI | InChI=1S/C16H23NO3/c1-2-16(12-6-5-7-13(18)10-12)19-11-15(20-16)14-8-3-4-9-17-14/h5-7,10,14-15,17-18H,2-4,8-9,11H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | UYAARRWROFVOEO-XHSDSOJGSA-N |
| XLogP | 2.51 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |