About cadmium;N,N-diethylformamide
cadmium;N,N-diethylformamide (PubChem CID 157494696) has the molecular formula C5H11CdNO
and a molecular weight of 213.56 g/mol. Its IUPAC name is cadmium;N,N-diethylformamide.
Molecular Properties
| Compound Name | cadmium;N,N-diethylformamide |
| PubChem CID | 157494696 |
| Molecular Formula | C5H11CdNO |
| Molecular Weight | 213.56 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | cadmium;N,N-diethylformamide |
| SMILES | CCN(C=O)CC.[Cd] |
| InChI | InChI=1S/C5H11NO.Cd/c1-3-6(4-2)5-7;/h5H,3-4H2,1-2H3; |
| InChIKey | BXROEJYXWIOMQA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cadmium;N,N-diethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;N,N-diethylformamide?
The IUPAC name of cadmium;N,N-diethylformamide (CID 157494696) is cadmium;N,N-diethylformamide.
What is the SMILES notation for cadmium;N,N-diethylformamide?
The canonical SMILES for cadmium;N,N-diethylformamide is CCN(C=O)CC.[Cd].
What is the InChIKey of cadmium;N,N-diethylformamide?
The InChIKey is BXROEJYXWIOMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.Cd/c1-3-6(4-2)5-7;/h5H,3-4H2,1-2H3;.
What are the key properties of cadmium;N,N-diethylformamide?
cadmium;N,N-diethylformamide has a molecular weight of 213.56 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;N,N-diethylformamide is sourced from PubChem (CID 157494696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).