C22H23NO2 — CID 15749477
(2S)-2-[(4S)-spiro[1,3-dioxolane-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-4-yl]piperidine (PubChem CID 15749477) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-2-[(4S)-spiro[1,3-dioxolane-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-4-yl]piperidine.
| Compound Name | (2S)-2-[(4S)-spiro[1,3-dioxolane-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-4-yl]piperidine |
|---|---|
| PubChem CID | 15749477 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-2-[(4S)-spiro[1,3-dioxolane-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-4-yl]piperidine |
| SMILES | C1=Cc2ccccc2C2(OC[C@H]([C@@H]3CCCCN3)O2)c2ccccc21 |
| InChI | InChI=1S/C22H23NO2/c1-3-9-18-16(7-1)12-13-17-8-2-4-10-19(17)22(18)24-15-21(25-22)20-11-5-6-14-23-20/h1-4,7-10,12-13,20-21,23H,5-6,11,14-15H2/t20-,21+/m0/s1 |
| InChIKey | VTMCNFHFOHBLOZ-LEWJYISDSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|