C27H25ClN4O2 — CID 157495658
[(1R,8S)-5-(3-chloro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone (PubChem CID 157495658) has the molecular formula C27H25ClN4O2 and a molecular weight of 472.98 g/mol. Its IUPAC name is [(1R,8S)-5-(3-chloro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone.
| Compound Name | [(1R,8S)-5-(3-chloro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 157495658 |
| Molecular Formula | C27H25ClN4O2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(1R,8S)-5-(3-chloro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
| SMILES | COc1cc(Cl)cc(-c2c3c(nn2C)[C@H]2CCC[C@@H](C3)N2C(=O)c2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C27H25ClN4O2/c1-31-26(18-12-19(28)14-21(13-18)34-2)22-15-20-6-3-7-24(25(22)30-31)32(20)27(33)17-8-9-23-16(11-17)5-4-10-29-23/h4-5,8-14,20,24H,3,6-7,15H2,1-2H3/t20-,24+/m0/s1 |
| InChIKey | BXUNYAFHGBBFQN-GBXCKJPGSA-N |
| XLogP | 5.59 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |