C19H33NO6 — CID 157496737
N-[2-hydroxy-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoxy)butoxy]propyl]-2-methylprop-2-enamide (PubChem CID 157496737) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is N-[2-hydroxy-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoxy)butoxy]propyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoxy)butoxy]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 157496737 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[2-hydroxy-3-[4-(2-hydroxy-6-methyl-5-oxohept-6-enoxy)butoxy]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)CCC(O)COCCCCOCC(O)CNC(=O)C(=C)C |
| InChI | InChI=1S/C19H33NO6/c1-14(2)18(23)8-7-16(21)12-25-9-5-6-10-26-13-17(22)11-20-19(24)15(3)4/h16-17,21-22H,1,3,5-13H2,2,4H3,(H,20,24) |
| InChIKey | LTNZCDSBZVYDNI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|