About tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate
tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate (PubChem CID 157496851) has the molecular formula C22H28N6O4S
and a molecular weight of 472.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate |
| PubChem CID | 157496851 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate |
| SMILES | Cc1cc2ncnc(-c3ccc(NCCNS(=O)(=O)NC(=O)OC(C)(C)C)nc3)c2cc1C |
| InChI | InChI=1S/C22H28N6O4S/c1-14-10-17-18(11-15(14)2)25-13-26-20(17)16-6-7-19(24-12-16)23-8-9-27-33(30,31)28-21(29)32-22(3,4)5/h6-7,10-13,27H,8-9H2,1-5H3,(H,23,24)(H,28,29) |
| InChIKey | MRFUYIRAIVPZNA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate (CID 157496851) is tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate is Cc1cc2ncnc(-c3ccc(NCCNS(=O)(=O)NC(=O)OC(C)(C)C)nc3)c2cc1C.
What is the InChIKey of tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate?
The InChIKey is MRFUYIRAIVPZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N6O4S/c1-14-10-17-18(11-15(14)2)25-13-26-20(17)16-6-7-19(24-12-16)23-8-9-27-33(30,31)28-21(29)32-22(3,4)5/h6-7,10-13,27H,8-9H2,1-5H3,(H,23,24)(H,28,29).
What are the key properties of tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate?
tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate has a molecular weight of 472.57 g/mol, XLogP of 3.08, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]amino]ethylsulfamoyl]carbamate is sourced from PubChem (CID 157496851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).