C29H31N3O4 — CID 157497141
methyl (17S,19S,20R,21S,24R)-21-hydroxy-26-isocyano-16-oxa-8,26-diazahexacyclo[15.11.1.02,7.08,29.09,14.019,24]nonacosa-1(29),2,4,6,9,11,13-heptaene-20-carboxylate (PubChem CID 157497141) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is methyl (17S,19S,20R,21S,24R)-21-hydroxy-26-isocyano-16-oxa-8,26-diazahexacyclo[15.11.1.02,7.08,29.09,14.019,24]nonacosa-1(29),2,4,6,9,11,13-heptaene-20-carboxylate.
| Compound Name | methyl (17S,19S,20R,21S,24R)-21-hydroxy-26-isocyano-16-oxa-8,26-diazahexacyclo[15.11.1.02,7.08,29.09,14.019,24]nonacosa-1(29),2,4,6,9,11,13-heptaene-20-carboxylate |
|---|---|
| PubChem CID | 157497141 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | methyl (17S,19S,20R,21S,24R)-21-hydroxy-26-isocyano-16-oxa-8,26-diazahexacyclo[15.11.1.02,7.08,29.09,14.019,24]nonacosa-1(29),2,4,6,9,11,13-heptaene-20-carboxylate |
| SMILES | [C-]#[N+]N1CCc2c3n(c4ccccc24)-c2ccccc2CO[C@H]3C[C@H]2[C@@H](CC[C@H](O)[C@@H]2C(=O)OC)C1 |
| InChI | InChI=1S/C29H31N3O4/c1-30-31-14-13-21-20-8-4-6-10-24(20)32-23-9-5-3-7-19(23)17-36-26(28(21)32)15-22-18(16-31)11-12-25(33)27(22)29(34)35-2/h3-10,18,22,25-27,33H,11-17H2,2H3/t18-,22-,25-,26-,27+/m0/s1 |
| InChIKey | RKLIKJMJUPEHSS-YJIVHAETSA-N |
| XLogP | 4.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|