About (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol
(2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol (PubChem CID 15749761) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol.
Molecular Properties
| Compound Name | (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol |
| PubChem CID | 15749761 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol |
| SMILES | C[C@@H]1CC(O)c2cccnc2O1 |
| InChI | InChI=1S/C9H11NO2/c1-6-5-8(11)7-3-2-4-10-9(7)12-6/h2-4,6,8,11H,5H2,1H3/t6-,8?/m1/s1 |
| InChIKey | QFRVBNAETXWZQU-XPJFZRNWSA-N |
| XLogP | 1.29 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol?
The IUPAC name of (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol (CID 15749761) is (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol.
What is the SMILES notation for (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol?
The canonical SMILES for (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol is C[C@@H]1CC(O)c2cccnc2O1.
What is the InChIKey of (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol?
The InChIKey is QFRVBNAETXWZQU-XPJFZRNWSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-5-8(11)7-3-2-4-10-9(7)12-6/h2-4,6,8,11H,5H2,1H3/t6-,8?/m1/s1.
What are the key properties of (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol?
(2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol has a molecular weight of 165.19 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-ol is sourced from PubChem (CID 15749761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).