C17H20Cl3N3O — CID 157497611
1,3,5-tris(chloromethyl)-2-(4-methoxynaphthalen-1-yl)-1,3,5-triazinane (PubChem CID 157497611) has the molecular formula C17H20Cl3N3O and a molecular weight of 388.73 g/mol. Its IUPAC name is 1,3,5-tris(chloromethyl)-2-(4-methoxynaphthalen-1-yl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(chloromethyl)-2-(4-methoxynaphthalen-1-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 157497611 |
| Molecular Formula | C17H20Cl3N3O |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1,3,5-tris(chloromethyl)-2-(4-methoxynaphthalen-1-yl)-1,3,5-triazinane |
| SMILES | COc1ccc(C2N(CCl)CN(CCl)CN2CCl)c2ccccc12 |
| InChI | InChI=1S/C17H20Cl3N3O/c1-24-16-7-6-15(13-4-2-3-5-14(13)16)17-22(9-19)11-21(8-18)12-23(17)10-20/h2-7,17H,8-12H2,1H3 |
| InChIKey | BYADFVDVECHFHL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|