C25H30N4O6S — CID 157498259
(7S,9aS)-7-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 157498259) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is (7S,9aS)-7-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (7S,9aS)-7-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 157498259 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | (7S,9aS)-7-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | COc1cccc(OC)c1-n1c(CS(=O)(=O)[C@H]2CC[C@@H]3CCCC(=O)N3C2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C25H30N4O6S/c1-16-10-13-21(35-16)25-27-26-22(29(25)24-19(33-2)7-5-8-20(24)34-3)15-36(31,32)18-12-11-17-6-4-9-23(30)28(17)14-18/h5,7-8,10,13,17-18H,4,6,9,11-12,14-15H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | ZUDMPVXYXIYXAA-ROUUACIJSA-N |
| XLogP | 3.31 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |