C30H40N4O3 — CID 157498467
N-[(1R,2S)-2-[1-[1-[[1-(4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-phenylethyl]cyclopentyl]acetamide (PubChem CID 157498467) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[(1R,2S)-2-[1-[1-[[1-(4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-phenylethyl]cyclopentyl]acetamide.
| Compound Name | N-[(1R,2S)-2-[1-[1-[[1-(4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-phenylethyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 157498467 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | N-[(1R,2S)-2-[1-[1-[[1-(4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-phenylethyl]cyclopentyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC[C@H]1C(C)(c1ccccc1)C1CCN(CC2CN(c3ccc([N+](=O)[O-])cc3)C2)CC1 |
| InChI | InChI=1S/C30H40N4O3/c1-22(35)31-29-10-6-9-28(29)30(2,24-7-4-3-5-8-24)25-15-17-32(18-16-25)19-23-20-33(21-23)26-11-13-27(14-12-26)34(36)37/h3-5,7-8,11-14,23,25,28-29H,6,9-10,15-21H2,1-2H3,(H,31,35)/t28-,29-,30?/m1/s1 |
| InChIKey | GLSZYYYZTYQDOC-HPSQJEMFSA-N |
| XLogP | 5.01 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|