About 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol
2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol (PubChem CID 15749854) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol |
| PubChem CID | 15749854 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol |
| SMILES | COc1cccc2c3c(c(NCCO)nc12)CCN3c1ccccc1C |
| InChI | InChI=1S/C21H23N3O2/c1-14-6-3-4-8-17(14)24-12-10-16-20(24)15-7-5-9-18(26-2)19(15)23-21(16)22-11-13-25/h3-9,25H,10-13H2,1-2H3,(H,22,23) |
| InChIKey | GFDDGXFKUNAXQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol?
The IUPAC name of 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol (CID 15749854) is 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol?
The canonical SMILES for 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol is COc1cccc2c3c(c(NCCO)nc12)CCN3c1ccccc1C.
What is the InChIKey of 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol?
The InChIKey is GFDDGXFKUNAXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-14-6-3-4-8-17(14)24-12-10-16-20(24)15-7-5-9-18(26-2)19(15)23-21(16)22-11-13-25/h3-9,25H,10-13H2,1-2H3,(H,22,23).
What are the key properties of 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol?
2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol has a molecular weight of 349.43 g/mol, XLogP of 3.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-methoxy-1-(2-methylphenyl)-2,3-dihydropyrrolo[3,2-c]quinolin-4-yl]amino]ethanol is sourced from PubChem (CID 15749854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).