C13H15F9OS — CID 157498628
3-methyl-5-(1,1,4,4,5,5,8,8,8-nonafluorooctyl)thiolan-2-one (PubChem CID 157498628) has the molecular formula C13H15F9OS and a molecular weight of 390.31 g/mol. Its IUPAC name is 3-methyl-5-(1,1,4,4,5,5,8,8,8-nonafluorooctyl)thiolan-2-one.
| Compound Name | 3-methyl-5-(1,1,4,4,5,5,8,8,8-nonafluorooctyl)thiolan-2-one |
|---|---|
| PubChem CID | 157498628 |
| Molecular Formula | C13H15F9OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-methyl-5-(1,1,4,4,5,5,8,8,8-nonafluorooctyl)thiolan-2-one |
| SMILES | CC1CC(C(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)F)SC1=O |
| InChI | InChI=1S/C13H15F9OS/c1-7-6-8(24-9(7)23)10(14,15)2-3-11(16,17)12(18,19)4-5-13(20,21)22/h7-8H,2-6H2,1H3 |
| InChIKey | BYDFOWDAWQVLIH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|