About oxane-2,6-dione;bis(oxolane-2,5-dione)
oxane-2,6-dione;bis(oxolane-2,5-dione) (PubChem CID 157499279) has the molecular formula C13H14O9
and a molecular weight of 314.25 g/mol. Its IUPAC name is oxane-2,6-dione;bis(oxolane-2,5-dione).
Molecular Properties
| Compound Name | oxane-2,6-dione;bis(oxolane-2,5-dione) |
| PubChem CID | 157499279 |
| Molecular Formula | C13H14O9 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | oxane-2,6-dione;bis(oxolane-2,5-dione) |
| SMILES | O=C1CCC(=O)O1.O=C1CCC(=O)O1.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C5H6O3.2C4H4O3/c6-4-2-1-3-5(7)8-4;2*5-3-1-2-4(6)7-3/h1-3H2;2*1-2H2 |
| InChIKey | BYFDJDIGZRGISM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze oxane-2,6-dione;bis(oxolane-2,5-dione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,6-dione;bis(oxolane-2,5-dione)?
The IUPAC name of oxane-2,6-dione;bis(oxolane-2,5-dione) (CID 157499279) is oxane-2,6-dione;bis(oxolane-2,5-dione).
What is the SMILES notation for oxane-2,6-dione;bis(oxolane-2,5-dione)?
The canonical SMILES for oxane-2,6-dione;bis(oxolane-2,5-dione) is O=C1CCC(=O)O1.O=C1CCC(=O)O1.O=C1CCCC(=O)O1.
What is the InChIKey of oxane-2,6-dione;bis(oxolane-2,5-dione)?
The InChIKey is BYFDJDIGZRGISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.2C4H4O3/c6-4-2-1-3-5(7)8-4;2*5-3-1-2-4(6)7-3/h1-3H2;2*1-2H2.
What are the key properties of oxane-2,6-dione;bis(oxolane-2,5-dione)?
oxane-2,6-dione;bis(oxolane-2,5-dione) has a molecular weight of 314.25 g/mol, XLogP of -0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,6-dione;bis(oxolane-2,5-dione) is sourced from PubChem (CID 157499279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).