C15H19N5O2S — CID 15750277
8-(2-methyl-1,3-thiazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 15750277) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 8-(2-methyl-1,3-thiazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-methyl-1,3-thiazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 15750277 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 8-(2-methyl-1,3-thiazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3csc(C)n3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C15H19N5O2S/c1-4-6-19-13-11(14(21)20(7-5-2)15(19)22)17-12(18-13)10-8-23-9(3)16-10/h8H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | KLNMDWXOKKWGJH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |