About 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione
8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 15750278) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| PubChem CID | 15750278 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cc4ccccc4o3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C19H20N4O3/c1-3-9-22-17-15(18(24)23(10-4-2)19(22)25)20-16(21-17)14-11-12-7-5-6-8-13(12)26-14/h5-8,11H,3-4,9-10H2,1-2H3,(H,20,21) |
| InChIKey | IJQATWJGFBRCTO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The IUPAC name of 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione (CID 15750278) is 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione is CCCn1c(=O)c2[nH]c(-c3cc4ccccc4o3)nc2n(CCC)c1=O.
What is the InChIKey of 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The InChIKey is IJQATWJGFBRCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-3-9-22-17-15(18(24)23(10-4-2)19(22)25)20-16(21-17)14-11-12-7-5-6-8-13(12)26-14/h5-8,11H,3-4,9-10H2,1-2H3,(H,20,21).
What are the key properties of 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione?
8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione has a molecular weight of 352.39 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-benzofuran-2-yl)-1,3-dipropyl-7H-purine-2,6-dione is sourced from PubChem (CID 15750278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).