About 4-methyl-2,6-bis(1-phenylethyl)phenol
4-methyl-2,6-bis(1-phenylethyl)phenol (PubChem CID 15751) has the molecular formula C23H24O
and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1-phenylethyl)phenol.
Molecular Properties
| Compound Name | 4-methyl-2,6-bis(1-phenylethyl)phenol |
| PubChem CID | 15751 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-methyl-2,6-bis(1-phenylethyl)phenol |
| SMILES | Cc1cc(C(C)c2ccccc2)c(O)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H24O/c1-16-14-21(17(2)19-10-6-4-7-11-19)23(24)22(15-16)18(3)20-12-8-5-9-13-20/h4-15,17-18,24H,1-3H3 |
| InChIKey | QFCGHEBLSUPGPF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2,6-bis(1-phenylethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-bis(1-phenylethyl)phenol?
The IUPAC name of 4-methyl-2,6-bis(1-phenylethyl)phenol (CID 15751) is 4-methyl-2,6-bis(1-phenylethyl)phenol.
What is the SMILES notation for 4-methyl-2,6-bis(1-phenylethyl)phenol?
The canonical SMILES for 4-methyl-2,6-bis(1-phenylethyl)phenol is Cc1cc(C(C)c2ccccc2)c(O)c(C(C)c2ccccc2)c1.
What is the InChIKey of 4-methyl-2,6-bis(1-phenylethyl)phenol?
The InChIKey is QFCGHEBLSUPGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O/c1-16-14-21(17(2)19-10-6-4-7-11-19)23(24)22(15-16)18(3)20-12-8-5-9-13-20/h4-15,17-18,24H,1-3H3.
What are the key properties of 4-methyl-2,6-bis(1-phenylethyl)phenol?
4-methyl-2,6-bis(1-phenylethyl)phenol has a molecular weight of 316.44 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-bis(1-phenylethyl)phenol is sourced from PubChem (CID 15751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).