About (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one
(9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one (PubChem CID 15751303) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one.
Molecular Properties
| Compound Name | (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one |
| PubChem CID | 15751303 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one |
| SMILES | COCOC1/C=C\CCCCC(=O)C(C)=C=CCCC1 |
| InChI | InChI=1S/C17H26O3/c1-15-10-6-5-8-12-16(20-14-19-2)11-7-3-4-9-13-17(15)18/h6-7,11,16H,3-5,8-9,12-14H2,1-2H3/b11-7- |
| InChIKey | JYIKGPQGAPOVPI-XFFZJAGNSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one?
The IUPAC name of (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one (CID 15751303) is (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one.
What is the SMILES notation for (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one?
The canonical SMILES for (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one is COCOC1/C=C\CCCCC(=O)C(C)=C=CCCC1.
What is the InChIKey of (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one?
The InChIKey is JYIKGPQGAPOVPI-XFFZJAGNSA-N. The full InChI is InChI=1S/C17H26O3/c1-15-10-6-5-8-12-16(20-14-19-2)11-7-3-4-9-13-17(15)18/h6-7,11,16H,3-5,8-9,12-14H2,1-2H3/b11-7-.
What are the key properties of (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one?
(9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one has a molecular weight of 278.39 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-8-(methoxymethoxy)-2-methylcyclotetradeca-2,3,9-trien-1-one is sourced from PubChem (CID 15751303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).