About 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine
4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine (PubChem CID 15751901) has the molecular formula C16H15NS2
and a molecular weight of 285.44 g/mol. Its IUPAC name is 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine |
| PubChem CID | 15751901 |
| Molecular Formula | C16H15NS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine |
| SMILES | c1ccc(CSC2=Nc3ccccc3SCC2)cc1 |
| InChI | InChI=1S/C16H15NS2/c1-2-6-13(7-3-1)12-19-16-10-11-18-15-9-5-4-8-14(15)17-16/h1-9H,10-12H2 |
| InChIKey | RHYABACHTBAAPD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine?
The IUPAC name of 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine (CID 15751901) is 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine.
What is the SMILES notation for 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine?
The canonical SMILES for 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine is c1ccc(CSC2=Nc3ccccc3SCC2)cc1.
What is the InChIKey of 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine?
The InChIKey is RHYABACHTBAAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NS2/c1-2-6-13(7-3-1)12-19-16-10-11-18-15-9-5-4-8-14(15)17-16/h1-9H,10-12H2.
What are the key properties of 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine?
4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine has a molecular weight of 285.44 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-2,3-dihydro-1,5-benzothiazepine is sourced from PubChem (CID 15751901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).