About 4-methyl-2,3-dihydro-1,5-benzothiazepine
4-methyl-2,3-dihydro-1,5-benzothiazepine (PubChem CID 15751915) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1,5-benzothiazepine |
| PubChem CID | 15751915 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,5-benzothiazepine |
| SMILES | CC1=Nc2ccccc2SCC1 |
| InChI | InChI=1S/C10H11NS/c1-8-6-7-12-10-5-3-2-4-9(10)11-8/h2-5H,6-7H2,1H3 |
| InChIKey | NVBURNDYWBNKFZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-dihydro-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1,5-benzothiazepine?
The IUPAC name of 4-methyl-2,3-dihydro-1,5-benzothiazepine (CID 15751915) is 4-methyl-2,3-dihydro-1,5-benzothiazepine.
What is the SMILES notation for 4-methyl-2,3-dihydro-1,5-benzothiazepine?
The canonical SMILES for 4-methyl-2,3-dihydro-1,5-benzothiazepine is CC1=Nc2ccccc2SCC1.
What is the InChIKey of 4-methyl-2,3-dihydro-1,5-benzothiazepine?
The InChIKey is NVBURNDYWBNKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-8-6-7-12-10-5-3-2-4-9(10)11-8/h2-5H,6-7H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1,5-benzothiazepine?
4-methyl-2,3-dihydro-1,5-benzothiazepine has a molecular weight of 177.27 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1,5-benzothiazepine is sourced from PubChem (CID 15751915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).